C13H12F3NO3 — CID 66790339
methyl (3R,4S)-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylate (PubChem CID 66790339) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is methyl (3R,4S)-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 66790339 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl (3R,4S)-6-oxo-4-(2,4,5-trifluorophenyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CNC(=O)C[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H12F3NO3/c1-20-13(19)8-5-17-12(18)3-6(8)7-2-10(15)11(16)4-9(7)14/h2,4,6,8H,3,5H2,1H3,(H,17,18)/t6-,8+/m1/s1 |
| InChIKey | UMBXJPFEJRDXGK-SVRRBLITSA-N |
| XLogP | 1.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|