C37H51N5O7S — CID 66790601
[(2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]hexyl] 2-(dimethylamino)acetate (PubChem CID 66790601) has the molecular formula C37H51N5O7S and a molecular weight of 709.91 g/mol. Its IUPAC name is [(2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]hexyl] 2-(dimethylamino)acetate.
| Compound Name | [(2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]hexyl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 66790601 |
| Molecular Formula | C37H51N5O7S |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | [(2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[[2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]hexyl] 2-(dimethylamino)acetate |
| SMILES | COC(=O)NC(C(=O)NCCCC[C@@H](COC(=O)CN(C)C)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H51N5O7S/c1-27(2)24-42(50(46,47)32-21-19-30(38)20-22-32)31(26-49-33(43)25-41(3)4)18-12-13-23-39-36(44)35(40-37(45)48-5)34(28-14-8-6-9-15-28)29-16-10-7-11-17-29/h6-11,14-17,19-22,27,31,34-35H,12-13,18,23-26,38H2,1-5H3,(H,39,44)(H,40,45)/t31-,35?/m0/s1 |
| InChIKey | RSUUGAYWTWJFRR-MWGAKABSSA-N |
| XLogP | 4.23 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|