About 2-chloro-4H-chromene
2-chloro-4H-chromene (PubChem CID 66790877) has the molecular formula C9H7ClO
and a molecular weight of 166.61 g/mol. Its IUPAC name is 2-chloro-4H-chromene.
Molecular Properties
| Compound Name | 2-chloro-4H-chromene |
| PubChem CID | 66790877 |
| Molecular Formula | C9H7ClO |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 2-chloro-4H-chromene |
| SMILES | ClC1=CCc2ccccc2O1 |
| InChI | InChI=1S/C9H7ClO/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4,6H,5H2 |
| InChIKey | IHGYCCCRDBPVDF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-4H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4H-chromene?
The IUPAC name of 2-chloro-4H-chromene (CID 66790877) is 2-chloro-4H-chromene.
What is the SMILES notation for 2-chloro-4H-chromene?
The canonical SMILES for 2-chloro-4H-chromene is ClC1=CCc2ccccc2O1.
What is the InChIKey of 2-chloro-4H-chromene?
The InChIKey is IHGYCCCRDBPVDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4,6H,5H2.
What are the key properties of 2-chloro-4H-chromene?
2-chloro-4H-chromene has a molecular weight of 166.61 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4H-chromene is sourced from PubChem (CID 66790877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).