C19H25N5O5 — CID 66790958
tert-butyl N-[[2-[[3-methoxy-4-(4-methylimidazol-1-yl)benzoyl]amino]acetyl]amino]carbamate (PubChem CID 66790958) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is tert-butyl N-[[2-[[3-methoxy-4-(4-methylimidazol-1-yl)benzoyl]amino]acetyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-[[3-methoxy-4-(4-methylimidazol-1-yl)benzoyl]amino]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 66790958 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | tert-butyl N-[[2-[[3-methoxy-4-(4-methylimidazol-1-yl)benzoyl]amino]acetyl]amino]carbamate |
| SMILES | COc1cc(C(=O)NCC(=O)NNC(=O)OC(C)(C)C)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C19H25N5O5/c1-12-10-24(11-21-12)14-7-6-13(8-15(14)28-5)17(26)20-9-16(25)22-23-18(27)29-19(2,3)4/h6-8,10-11H,9H2,1-5H3,(H,20,26)(H,22,25)(H,23,27) |
| InChIKey | KWOYHYZHHUKDKI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|