C16H14F2N2O2 — CID 66791117
7-amino-4-(3,4-difluorophenyl)-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 66791117) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is 7-amino-4-(3,4-difluorophenyl)-2,2-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-4-(3,4-difluorophenyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 66791117 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 7-amino-4-(3,4-difluorophenyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2cc(N)ccc2N(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C16H14F2N2O2/c1-16(2)15(21)20(10-4-5-11(17)12(18)8-10)13-6-3-9(19)7-14(13)22-16/h3-8H,19H2,1-2H3 |
| InChIKey | KXSHLVAMKOIMMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|