C28H34N6OSSi — CID 66791158
5-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrimidine-2,4-diamine (PubChem CID 66791158) has the molecular formula C28H34N6OSSi and a molecular weight of 530.77 g/mol. Its IUPAC name is 5-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66791158 |
| Molecular Formula | C28H34N6OSSi |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 5-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-4-N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCNc1nc(N)ncc1-c1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C28H34N6OSSi/c1-28(2,3)37(4,5)35-12-8-11-30-26-22(17-31-27(29)33-26)19-13-20-16-32-34-25(20)21(14-19)24-15-18-9-6-7-10-23(18)36-24/h6-7,9-10,13-17H,8,11-12H2,1-5H3,(H,32,34)(H3,29,30,31,33) |
| InChIKey | CEYXDOGRJYKPJI-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|