C27H35BN2O3SSi — CID 66791287
2-[[7-(1-benzothiophen-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 66791287) has the molecular formula C27H35BN2O3SSi and a molecular weight of 506.55 g/mol. Its IUPAC name is 2-[[7-(1-benzothiophen-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-(1-benzothiophen-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 66791287 |
| Molecular Formula | C27H35BN2O3SSi |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-[[7-(1-benzothiophen-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)OB(c2cc(-c3cc4ccccc4s3)c3nn(COCC[Si](C)(C)C)cc3c2)OC1(C)C |
| InChI | InChI=1S/C27H35BN2O3SSi/c1-26(2)27(3,4)33-28(32-26)21-14-20-17-30(18-31-12-13-35(5,6)7)29-25(20)22(16-21)24-15-19-10-8-9-11-23(19)34-24/h8-11,14-17H,12-13,18H2,1-7H3 |
| InChIKey | ZCELRYIHOUJDOL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|