C37H46N8OSSi — CID 66791296
N-[[7-[7-(1-benzothiophen-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-5-(2-piperidin-3-ylethyl)pyrrolo[3,2-d]pyrimidin-2-yl]methylideneamino]-N-methylmethanamine (PubChem CID 66791296) has the molecular formula C37H46N8OSSi and a molecular weight of 678.98 g/mol. Its IUPAC name is N-[[7-[7-(1-benzothiophen-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-5-(2-piperidin-3-ylethyl)pyrrolo[3,2-d]pyrimidin-2-yl]methylideneamino]-N-methylmethanamine.
| Compound Name | N-[[7-[7-(1-benzothiophen-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-5-(2-piperidin-3-ylethyl)pyrrolo[3,2-d]pyrimidin-2-yl]methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 66791296 |
| Molecular Formula | C37H46N8OSSi |
| Molecular Weight | 678.98 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | N-[[7-[7-(1-benzothiophen-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-5-(2-piperidin-3-ylethyl)pyrrolo[3,2-d]pyrimidin-2-yl]methylideneamino]-N-methylmethanamine |
| SMILES | CN(C)N=Cc1ncc2c(n1)c(-c1cc(-c3cc4ccccc4s3)c3c(cnn3COCC[Si](C)(C)C)c1)cn2CCC1CCCNC1 |
| InChI | InChI=1S/C37H46N8OSSi/c1-43(2)40-23-35-39-22-32-36(42-35)31(24-44(32)14-12-26-9-8-13-38-20-26)28-17-29-21-41-45(25-46-15-16-48(3,4)5)37(29)30(18-28)34-19-27-10-6-7-11-33(27)47-34/h6-7,10-11,17-19,21-24,26,38H,8-9,12-16,20,25H2,1-5H3 |
| InChIKey | YECQXYRDGAXQEI-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.98 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|