C16H21BN2O3 — CID 66791461
2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]acetamide (PubChem CID 66791461) has the molecular formula C16H21BN2O3 and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]acetamide.
| Compound Name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 66791461 |
| Molecular Formula | C16H21BN2O3 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]acetamide |
| SMILES | CC1(C)OB(c2ccc3c(ccn3CC(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C16H21BN2O3/c1-15(2)16(3,4)22-17(21-15)12-5-6-13-11(9-12)7-8-19(13)10-14(18)20/h5-9H,10H2,1-4H3,(H2,18,20) |
| InChIKey | LRSSYXSVTBLXHO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|