C8H12N6 — CID 66791926
2-N,2-N,9-trimethylpurine-2,6-diamine (PubChem CID 66791926) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-N,2-N,9-trimethylpurine-2,6-diamine.
| Compound Name | 2-N,2-N,9-trimethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 66791926 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-N,2-N,9-trimethylpurine-2,6-diamine |
| SMILES | CN(C)c1nc(N)c2ncn(C)c2n1 |
| InChI | InChI=1S/C8H12N6/c1-13(2)8-11-6(9)5-7(12-8)14(3)4-10-5/h4H,1-3H3,(H2,9,11,12) |
| InChIKey | OOMBLDUAKHCRHO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |