C12H17I — CID 66792612
2-(1-iodoethyl)-1,4,5-trimethyl-3-methylidenecyclohexa-1,4-diene (PubChem CID 66792612) has the molecular formula C12H17I and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-(1-iodoethyl)-1,4,5-trimethyl-3-methylidenecyclohexa-1,4-diene.
| Compound Name | 2-(1-iodoethyl)-1,4,5-trimethyl-3-methylidenecyclohexa-1,4-diene |
|---|---|
| PubChem CID | 66792612 |
| Molecular Formula | C12H17I |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-(1-iodoethyl)-1,4,5-trimethyl-3-methylidenecyclohexa-1,4-diene |
| SMILES | C=C1C(C)=C(C)CC(C)=C1C(C)I |
| InChI | InChI=1S/C12H17I/c1-7-6-8(2)12(11(5)13)10(4)9(7)3/h11H,4,6H2,1-3,5H3 |
| InChIKey | QCZIBOQLNMGDDA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|