C17H20N2O — CID 66793301
1-(oxan-2-yl)-5-pent-1-ynylindazole (PubChem CID 66793301) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(oxan-2-yl)-5-pent-1-ynylindazole.
| Compound Name | 1-(oxan-2-yl)-5-pent-1-ynylindazole |
|---|---|
| PubChem CID | 66793301 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(oxan-2-yl)-5-pent-1-ynylindazole |
| SMILES | CCCC#Cc1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C17H20N2O/c1-2-3-4-7-14-9-10-16-15(12-14)13-18-19(16)17-8-5-6-11-20-17/h9-10,12-13,17H,2-3,5-6,8,11H2,1H3 |
| InChIKey | FMOTUHLOTYGGAM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|