C13H15NO5 — CID 66793341
3-acetamido-2-ethoxycarbonyl-6-methylbenzoic acid (PubChem CID 66793341) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-acetamido-2-ethoxycarbonyl-6-methylbenzoic acid.
| Compound Name | 3-acetamido-2-ethoxycarbonyl-6-methylbenzoic acid |
|---|---|
| PubChem CID | 66793341 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-acetamido-2-ethoxycarbonyl-6-methylbenzoic acid |
| SMILES | CCOC(=O)c1c(NC(C)=O)ccc(C)c1C(=O)O |
| InChI | InChI=1S/C13H15NO5/c1-4-19-13(18)11-9(14-8(3)15)6-5-7(2)10(11)12(16)17/h5-6H,4H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | RUWGPSZQFWBSFI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |