C12H22O12 — CID 66793908
(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid (PubChem CID 66793908) has the molecular formula C12H22O12 and a molecular weight of 358.30 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 66793908 |
| Molecular Formula | C12H22O12 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid |
| SMILES | O=C(O)[C@@](O)(C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O12/c13-1-3(15)5(16)9(20)12(23,11(21)22)10-8(19)7(18)6(17)4(2-14)24-10/h3-10,13-20,23H,1-2H2,(H,21,22)/t3-,4-,5-,6+,7+,8-,9+,10?,12+/m1/s1 |
| InChIKey | UVIBIHXLKFBTAF-VFJCRJIJSA-N |
| XLogP | -6.28 |
| TPSA | 228.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -6.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |