About (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate
(4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate (PubChem CID 66793989) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate.
Molecular Properties
| Compound Name | (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate |
| PubChem CID | 66793989 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate |
| SMILES | CON1CCC(OC(=O)Cc2c(C)cc(C)cc2C)(C(N)=O)CC1 |
| InChI | InChI=1S/C18H26N2O4/c1-12-9-13(2)15(14(3)10-12)11-16(21)24-18(17(19)22)5-7-20(23-4)8-6-18/h9-10H,5-8,11H2,1-4H3,(H2,19,22) |
| InChIKey | NQKBQLOEZXDJQW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
The IUPAC name of (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate (CID 66793989) is (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate.
What is the SMILES notation for (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
The canonical SMILES for (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate is CON1CCC(OC(=O)Cc2c(C)cc(C)cc2C)(C(N)=O)CC1.
What is the InChIKey of (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
The InChIKey is NQKBQLOEZXDJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-12-9-13(2)15(14(3)10-12)11-16(21)24-18(17(19)22)5-7-20(23-4)8-6-18/h9-10H,5-8,11H2,1-4H3,(H2,19,22).
What are the key properties of (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate?
(4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate has a molecular weight of 334.42 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamoyl-1-methoxypiperidin-4-yl) 2-(2,4,6-trimethylphenyl)acetate is sourced from PubChem (CID 66793989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).