C23H34N2O2 — CID 66794168
1,5-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)pentane-1,5-dione (PubChem CID 66794168) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1,5-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)pentane-1,5-dione.
| Compound Name | 1,5-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)pentane-1,5-dione |
|---|---|
| PubChem CID | 66794168 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 1,5-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCC2CCCC=C2C1)N1CCC2CCCC=C2C1 |
| InChI | InChI=1S/C23H34N2O2/c26-22(24-14-12-18-6-1-3-8-20(18)16-24)10-5-11-23(27)25-15-13-19-7-2-4-9-21(19)17-25/h8-9,18-19H,1-7,10-17H2 |
| InChIKey | OJBPMLFFNGTLKH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|