C29H38O4 — CID 66794304
bis(prop-2-enyl) benzene-1,2-dicarboxylate;1,2,3-tri(propan-2-yl)benzene (PubChem CID 66794304) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is bis(prop-2-enyl) benzene-1,2-dicarboxylate;1,2,3-tri(propan-2-yl)benzene.
| Compound Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate;1,2,3-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 66794304 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | bis(prop-2-enyl) benzene-1,2-dicarboxylate;1,2,3-tri(propan-2-yl)benzene |
| SMILES | C=CCOC(=O)c1ccccc1C(=O)OCC=C.CC(C)c1cccc(C(C)C)c1C(C)C |
| InChI | InChI=1S/C15H24.C14H14O4/c1-10(2)13-8-7-9-14(11(3)4)15(13)12(5)6;1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h7-12H,1-6H3;3-8H,1-2,9-10H2 |
| InChIKey | LARZCYAHHAZVSA-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|