C20H30N2O3 — CID 66794415
1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(4-oxopiperidin-1-yl)hexane-1,6-dione (PubChem CID 66794415) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(4-oxopiperidin-1-yl)hexane-1,6-dione.
| Compound Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(4-oxopiperidin-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 66794415 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(4-oxopiperidin-1-yl)hexane-1,6-dione |
| SMILES | O=C1CCN(C(=O)CCCCC(=O)N2CCC3CCCC=C3C2)CC1 |
| InChI | InChI=1S/C20H30N2O3/c23-18-10-13-21(14-11-18)19(24)7-3-4-8-20(25)22-12-9-16-5-1-2-6-17(16)15-22/h6,16H,1-5,7-15H2 |
| InChIKey | MWLVXDFNSSKNNH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|