C18H30F2N2O3S — CID 66794437
4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1-(3,3-difluoropiperidin-1-yl)butan-1-one (PubChem CID 66794437) has the molecular formula C18H30F2N2O3S and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1-(3,3-difluoropiperidin-1-yl)butan-1-one.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1-(3,3-difluoropiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 66794437 |
| Molecular Formula | C18H30F2N2O3S |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1-(3,3-difluoropiperidin-1-yl)butan-1-one |
| SMILES | O=C(CCCS(=O)(=O)N1CCC2CCCCC2C1)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C18H30F2N2O3S/c19-18(20)9-4-10-21(14-18)17(23)7-3-12-26(24,25)22-11-8-15-5-1-2-6-16(15)13-22/h15-16H,1-14H2 |
| InChIKey | LWSDEKLFIFXPNG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |