C24H36N2O2 — CID 66794451
1,6-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)hexane-1,6-dione (PubChem CID 66794451) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1,6-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)hexane-1,6-dione.
| Compound Name | 1,6-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 66794451 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1,6-bis(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1CCC2CCCC=C2C1)N1CCC2CCCC=C2C1 |
| InChI | InChI=1S/C24H36N2O2/c27-23(25-15-13-19-7-1-3-9-21(19)17-25)11-5-6-12-24(28)26-16-14-20-8-2-4-10-22(20)18-26/h9-10,19-20H,1-8,11-18H2 |
| InChIKey | BOFXQGDTKZWWPD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|