C14H24N2O — CID 66794527
1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-aminopentan-1-one (PubChem CID 66794527) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-aminopentan-1-one.
| Compound Name | 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-aminopentan-1-one |
|---|---|
| PubChem CID | 66794527 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-aminopentan-1-one |
| SMILES | NCCCCC(=O)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C14H24N2O/c15-10-4-3-9-14(17)16-11-5-7-12-6-1-2-8-13(12)16/h8,12H,1-7,9-11,15H2 |
| InChIKey | KBXKXYBKSSOOIR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|