C18H32N2O2 — CID 66794685
6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-ethyl-N-methyl-6-oxohexanamide (PubChem CID 66794685) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-ethyl-N-methyl-6-oxohexanamide.
| Compound Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-ethyl-N-methyl-6-oxohexanamide |
|---|---|
| PubChem CID | 66794685 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-ethyl-N-methyl-6-oxohexanamide |
| SMILES | CCN(C)C(=O)CCCCC(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C18H32N2O2/c1-3-19(2)17(21)10-6-7-11-18(22)20-13-12-15-8-4-5-9-16(15)14-20/h15-16H,3-14H2,1-2H3 |
| InChIKey | OYMWVODYXAWEGS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|