C16H27N3O2 — CID 66794703
1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-butan-2-ylurea (PubChem CID 66794703) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-butan-2-ylurea.
| Compound Name | 1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-butan-2-ylurea |
|---|---|
| PubChem CID | 66794703 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-[2-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-butan-2-ylurea |
| SMILES | CCC(C)NC(=O)NCC(=O)N1CCC2CCCC=C2C1 |
| InChI | InChI=1S/C16H27N3O2/c1-3-12(2)18-16(21)17-10-15(20)19-9-8-13-6-4-5-7-14(13)11-19/h7,12-13H,3-6,8-11H2,1-2H3,(H2,17,18,21) |
| InChIKey | VOXQKZDFAPZHEC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|