C21H28N2O3 — CID 66794901
(2R,6S)-4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 66794901) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R,6S)-4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (2R,6S)-4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 66794901 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (2R,6S)-4-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C(CN1C(=O)[C@@H]2C3C=CC(CC3)[C@@H]2C1=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C21H28N2O3/c24-17(22-10-9-13-3-1-2-4-16(13)11-22)12-23-20(25)18-14-5-6-15(8-7-14)19(18)21(23)26/h5-6,13-16,18-19H,1-4,7-12H2/t13?,14?,15?,16?,18-,19+ |
| InChIKey | ODXFKTUBRXVKAV-ZOOLXUSTSA-N |
| XLogP | 2.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|