C22H36N2O2 — CID 66794958
1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(3,5-dimethylpiperidin-1-yl)hexane-1,6-dione (PubChem CID 66794958) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(3,5-dimethylpiperidin-1-yl)hexane-1,6-dione.
| Compound Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(3,5-dimethylpiperidin-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 66794958 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-6-(3,5-dimethylpiperidin-1-yl)hexane-1,6-dione |
| SMILES | CC1CC(C)CN(C(=O)CCCCC(=O)N2CCC3CCCC=C3C2)C1 |
| InChI | InChI=1S/C22H36N2O2/c1-17-13-18(2)15-24(14-17)22(26)10-6-5-9-21(25)23-12-11-19-7-3-4-8-20(19)16-23/h8,17-19H,3-7,9-16H2,1-2H3 |
| InChIKey | JAKIQSNCNMWQRU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|