C20H32N2O2 — CID 66795007
N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclopentylacetamide (PubChem CID 66795007) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclopentylacetamide.
| Compound Name | N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 66795007 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclopentylacetamide |
| SMILES | O=C(CC1CCCC1)NCCCC(=O)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C20H32N2O2/c23-19(15-16-7-1-2-8-16)21-13-5-12-20(24)22-14-6-10-17-9-3-4-11-18(17)22/h11,16-17H,1-10,12-15H2,(H,21,23) |
| InChIKey | JYBRPVCLBFUMFV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|