C21H34N2O2 — CID 66795016
N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclohexylacetamide (PubChem CID 66795016) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclohexylacetamide.
| Compound Name | N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 66795016 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)NCCCC(=O)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C21H34N2O2/c24-20(16-17-8-2-1-3-9-17)22-14-6-13-21(25)23-15-7-11-18-10-4-5-12-19(18)23/h12,17-18H,1-11,13-16H2,(H,22,24) |
| InChIKey | QIYXADKIQPVVEZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|