C21H36N2O2 — CID 66795375
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(azepan-1-yl)hexane-1,6-dione (PubChem CID 66795375) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(azepan-1-yl)hexane-1,6-dione.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(azepan-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 66795375 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(azepan-1-yl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1CCCC2CCCCC21)N1CCCCCC1 |
| InChI | InChI=1S/C21H36N2O2/c24-20(22-15-7-1-2-8-16-22)13-5-6-14-21(25)23-17-9-11-18-10-3-4-12-19(18)23/h18-19H,1-17H2 |
| InChIKey | QFWXVJCQCQDFBX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|