C24H30N4O5 — CID 66795700
4-[[4-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]butanoic acid (PubChem CID 66795700) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[[4-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]butanoic acid.
| Compound Name | 4-[[4-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]butanoic acid |
|---|---|
| PubChem CID | 66795700 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-[[4-[5-[1-cyclohexyl-5-(methoxymethyl)pyrazol-4-yl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]butanoic acid |
| SMILES | COCc1c(-c2nc(-c3ccc(COCCCC(=O)O)cc3)no2)cnn1C1CCCCC1 |
| InChI | InChI=1S/C24H30N4O5/c1-31-16-21-20(14-25-28(21)19-6-3-2-4-7-19)24-26-23(27-33-24)18-11-9-17(10-12-18)15-32-13-5-8-22(29)30/h9-12,14,19H,2-8,13,15-16H2,1H3,(H,29,30) |
| InChIKey | RZFVBYDSTWFMIS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|