C24H28BNO2 — CID 66795850
2-methyl-N-[[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methyl]aniline (PubChem CID 66795850) has the molecular formula C24H28BNO2 and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-methyl-N-[[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methyl]aniline.
| Compound Name | 2-methyl-N-[[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 66795850 |
| Molecular Formula | C24H28BNO2 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-methyl-N-[[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]methyl]aniline |
| SMILES | Cc1ccccc1NCc1ccc2ccccc2c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H28BNO2/c1-17-10-6-9-13-21(17)26-16-19-15-14-18-11-7-8-12-20(18)22(19)25-27-23(2,3)24(4,5)28-25/h6-15,26H,16H2,1-5H3 |
| InChIKey | RYCKQAGIYIZSSM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|