About N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide
N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide (PubChem CID 66796005) has the molecular formula C22H38N2O2
and a molecular weight of 362.56 g/mol. Its IUPAC name is N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide.
Molecular Properties
| Compound Name | N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide |
| PubChem CID | 66796005 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide |
| SMILES | CCCCCCCC(=O)NC1=C(NC(=O)CCCCCCC)CCC=C1 |
| InChI | InChI=1S/C22H38N2O2/c1-3-5-7-9-11-17-21(25)23-19-15-13-14-16-20(19)24-22(26)18-12-10-8-6-4-2/h13,15H,3-12,14,16-18H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | RAPRXHVAJPZRCR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide?
The IUPAC name of N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide (CID 66796005) is N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide.
What is the SMILES notation for N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide?
The canonical SMILES for N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide is CCCCCCCC(=O)NC1=C(NC(=O)CCCCCCC)CCC=C1.
What is the InChIKey of N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide?
The InChIKey is RAPRXHVAJPZRCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38N2O2/c1-3-5-7-9-11-17-21(25)23-19-15-13-14-16-20(19)24-22(26)18-12-10-8-6-4-2/h13,15H,3-12,14,16-18H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide?
N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide has a molecular weight of 362.56 g/mol, XLogP of 5.50, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(octanoylamino)cyclohexa-1,3-dien-1-yl]octanamide is sourced from PubChem (CID 66796005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).