About N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide
N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide (PubChem CID 66796008) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide.
Molecular Properties
| Compound Name | N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide |
| PubChem CID | 66796008 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide |
| SMILES | CCCC(=O)NC1=C(NC(=O)CCC)CCC=C1 |
| InChI | InChI=1S/C14H22N2O2/c1-3-7-13(17)15-11-9-5-6-10-12(11)16-14(18)8-4-2/h5,9H,3-4,6-8,10H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | MTSOYVJVSCFNDL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
The IUPAC name of N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide (CID 66796008) is N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide.
What is the SMILES notation for N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
The canonical SMILES for N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide is CCCC(=O)NC1=C(NC(=O)CCC)CCC=C1.
What is the InChIKey of N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
The InChIKey is MTSOYVJVSCFNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-3-7-13(17)15-11-9-5-6-10-12(11)16-14(18)8-4-2/h5,9H,3-4,6-8,10H2,1-2H3,(H,15,17)(H,16,18).
What are the key properties of N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide has a molecular weight of 250.34 g/mol, XLogP of 2.38, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(butanoylamino)cyclohexa-1,3-dien-1-yl]butanamide is sourced from PubChem (CID 66796008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).