About (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane
(2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane (PubChem CID 66796121) has the molecular formula C8H14F4O3S
and a molecular weight of 266.26 g/mol. Its IUPAC name is (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane.
Molecular Properties
| Compound Name | (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane |
| PubChem CID | 66796121 |
| Molecular Formula | C8H14F4O3S |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane |
| SMILES | O=S(O)(O)(CC(F)(F)F)C1CCCCC1F |
| InChI | InChI=1S/C8H14F4O3S/c9-6-3-1-2-4-7(6)16(13,14,15)5-8(10,11)12/h6-7H,1-5H2,(H2,13,14,15) |
| InChIKey | CYNGRFVQZZVWKX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane?
The IUPAC name of (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane (CID 66796121) is (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane.
What is the SMILES notation for (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane?
The canonical SMILES for (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane is O=S(O)(O)(CC(F)(F)F)C1CCCCC1F.
What is the InChIKey of (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane?
The InChIKey is CYNGRFVQZZVWKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F4O3S/c9-6-3-1-2-4-7(6)16(13,14,15)5-8(10,11)12/h6-7H,1-5H2,(H2,13,14,15).
What are the key properties of (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane?
(2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane has a molecular weight of 266.26 g/mol, XLogP of 2.60, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorocyclohexyl)-dihydroxy-oxo-(2,2,2-trifluoroethyl)-λ6-sulfane is sourced from PubChem (CID 66796121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).