About N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide
N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide (PubChem CID 66796149) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide |
| PubChem CID | 66796149 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)ccc1C |
| InChI | InChI=1S/C12H18N2/c1-5-14(4)9-13-12-8-10(2)6-7-11(12)3/h6-9H,5H2,1-4H3/b13-9+ |
| InChIKey | NNXBMYXUXUUEER-UKTHLTGXSA-N |
| XLogP | 2.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide?
The IUPAC name of N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide (CID 66796149) is N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide.
What is the SMILES notation for N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide?
The canonical SMILES for N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide is CCN(C)/C=N/c1cc(C)ccc1C.
What is the InChIKey of N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide?
The InChIKey is NNXBMYXUXUUEER-UKTHLTGXSA-N. The full InChI is InChI=1S/C12H18N2/c1-5-14(4)9-13-12-8-10(2)6-7-11(12)3/h6-9H,5H2,1-4H3/b13-9+.
What are the key properties of N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide?
N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide has a molecular weight of 190.29 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide is sourced from PubChem (CID 66796149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).