C16H18FO3P — CID 66796239
[4-(2-fluorophenyl)-1-phenylbutyl]phosphonic acid (PubChem CID 66796239) has the molecular formula C16H18FO3P and a molecular weight of 308.29 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-1-phenylbutyl]phosphonic acid.
| Compound Name | [4-(2-fluorophenyl)-1-phenylbutyl]phosphonic acid |
|---|---|
| PubChem CID | 66796239 |
| Molecular Formula | C16H18FO3P |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [4-(2-fluorophenyl)-1-phenylbutyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CCCc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C16H18FO3P/c17-15-11-5-4-7-13(15)10-6-12-16(21(18,19)20)14-8-2-1-3-9-14/h1-5,7-9,11,16H,6,10,12H2,(H2,18,19,20) |
| InChIKey | FBRDMVJRKGKQLG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|