C14H13F2O3P — CID 66796365
[1-(2-fluorophenyl)-1-(4-fluorophenyl)ethyl]phosphonic acid (PubChem CID 66796365) has the molecular formula C14H13F2O3P and a molecular weight of 298.23 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-1-(4-fluorophenyl)ethyl]phosphonic acid.
| Compound Name | [1-(2-fluorophenyl)-1-(4-fluorophenyl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 66796365 |
| Molecular Formula | C14H13F2O3P |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [1-(2-fluorophenyl)-1-(4-fluorophenyl)ethyl]phosphonic acid |
| SMILES | CC(c1ccc(F)cc1)(c1ccccc1F)P(=O)(O)O |
| InChI | InChI=1S/C14H13F2O3P/c1-14(20(17,18)19,10-6-8-11(15)9-7-10)12-4-2-3-5-13(12)16/h2-9H,1H3,(H2,17,18,19) |
| InChIKey | GQOBJCVROVMNAT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|