About [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium
[3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium (PubChem CID 66796448) has the molecular formula C10H11F3O2P+
and a molecular weight of 251.16 g/mol. Its IUPAC name is [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium.
Molecular Properties
| Compound Name | [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium |
| PubChem CID | 66796448 |
| Molecular Formula | C10H11F3O2P+ |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium |
| SMILES | CCc1cccc([P+](=O)O)c1CC(F)(F)F |
| InChI | InChI=1S/C10H10F3O2P/c1-2-7-4-3-5-9(16(14)15)8(7)6-10(11,12)13/h3-5H,2,6H2,1H3/p+1 |
| InChIKey | XNOWPJZGUXTRNP-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium?
The IUPAC name of [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium (CID 66796448) is [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium.
What is the SMILES notation for [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium?
The canonical SMILES for [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium is CCc1cccc([P+](=O)O)c1CC(F)(F)F.
What is the InChIKey of [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium?
The InChIKey is XNOWPJZGUXTRNP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10F3O2P/c1-2-7-4-3-5-9(16(14)15)8(7)6-10(11,12)13/h3-5H,2,6H2,1H3/p+1.
What are the key properties of [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium?
[3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium has a molecular weight of 251.16 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-ethyl-2-(2,2,2-trifluoroethyl)phenyl]-hydroxy-oxophosphanium is sourced from PubChem (CID 66796448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).