About [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane
[ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane (PubChem CID 66796520) has the molecular formula C10H18F3O2P
and a molecular weight of 258.22 g/mol. Its IUPAC name is [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane.
Molecular Properties
| Compound Name | [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane |
| PubChem CID | 66796520 |
| Molecular Formula | C10H18F3O2P |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane |
| SMILES | CCOP(=O)(CC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H18F3O2P/c1-2-15-16(14,8-10(11,12)13)9-6-4-3-5-7-9/h9H,2-8H2,1H3 |
| InChIKey | XAERDZQGMFFULT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane?
The IUPAC name of [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane (CID 66796520) is [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane.
What is the SMILES notation for [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane?
The canonical SMILES for [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane is CCOP(=O)(CC(F)(F)F)C1CCCCC1.
What is the InChIKey of [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane?
The InChIKey is XAERDZQGMFFULT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3O2P/c1-2-15-16(14,8-10(11,12)13)9-6-4-3-5-7-9/h9H,2-8H2,1H3.
What are the key properties of [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane?
[ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane has a molecular weight of 258.22 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(2,2,2-trifluoroethyl)phosphoryl]cyclohexane is sourced from PubChem (CID 66796520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).