About hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium
hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium (PubChem CID 66796597) has the molecular formula C9H15F3O2P+
and a molecular weight of 243.18 g/mol. Its IUPAC name is hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium.
Molecular Properties
| Compound Name | hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium |
| PubChem CID | 66796597 |
| Molecular Formula | C9H15F3O2P+ |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium |
| SMILES | O=[P+](O)CC1(CC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C9H14F3O2P/c10-9(11,12)6-8(7-15(13)14)4-2-1-3-5-8/h1-7H2/p+1 |
| InChIKey | IPDAODLBFGPNAX-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium?
The IUPAC name of hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium (CID 66796597) is hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium.
What is the SMILES notation for hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium?
The canonical SMILES for hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium is O=[P+](O)CC1(CC(F)(F)F)CCCCC1.
What is the InChIKey of hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium?
The InChIKey is IPDAODLBFGPNAX-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H14F3O2P/c10-9(11,12)6-8(7-15(13)14)4-2-1-3-5-8/h1-7H2/p+1.
What are the key properties of hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium?
hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium has a molecular weight of 243.18 g/mol, XLogP of 3.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-[[1-(2,2,2-trifluoroethyl)cyclohexyl]methyl]phosphanium is sourced from PubChem (CID 66796597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).