C21H23Cl2N3O3 — CID 66796692
(5-phenylfuran-2-yl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 66796692) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is (5-phenylfuran-2-yl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (5-phenylfuran-2-yl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 66796692 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (5-phenylfuran-2-yl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccc(-c2ccccc2)o1)N1CCNCC1COc1cccnc1 |
| InChI | InChI=1S/C21H21N3O3.2ClH/c25-21(20-9-8-19(27-20)16-5-2-1-3-6-16)24-12-11-23-13-17(24)15-26-18-7-4-10-22-14-18;;/h1-10,14,17,23H,11-13,15H2;2*1H |
| InChIKey | RSQAVIVFMMVFFA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |