About (1-phenylcyclopentyl) hydrogen sulfite
(1-phenylcyclopentyl) hydrogen sulfite (PubChem CID 66796702) has the molecular formula C11H14O3S
and a molecular weight of 226.30 g/mol. Its IUPAC name is (1-phenylcyclopentyl) hydrogen sulfite.
Molecular Properties
| Compound Name | (1-phenylcyclopentyl) hydrogen sulfite |
| PubChem CID | 66796702 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (1-phenylcyclopentyl) hydrogen sulfite |
| SMILES | O=S(O)OC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C11H14O3S/c12-15(13)14-11(8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,12,13) |
| InChIKey | KDIBPXRHPOIWBP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (1-phenylcyclopentyl) hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenylcyclopentyl) hydrogen sulfite?
The IUPAC name of (1-phenylcyclopentyl) hydrogen sulfite (CID 66796702) is (1-phenylcyclopentyl) hydrogen sulfite.
What is the SMILES notation for (1-phenylcyclopentyl) hydrogen sulfite?
The canonical SMILES for (1-phenylcyclopentyl) hydrogen sulfite is O=S(O)OC1(c2ccccc2)CCCC1.
What is the InChIKey of (1-phenylcyclopentyl) hydrogen sulfite?
The InChIKey is KDIBPXRHPOIWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S/c12-15(13)14-11(8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,12,13).
What are the key properties of (1-phenylcyclopentyl) hydrogen sulfite?
(1-phenylcyclopentyl) hydrogen sulfite has a molecular weight of 226.30 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenylcyclopentyl) hydrogen sulfite is sourced from PubChem (CID 66796702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).