C10H17F4O3P — CID 66796837
[4,4,4-trifluoro-2-(2-fluorocyclohexyl)butan-2-yl]phosphonic acid (PubChem CID 66796837) has the molecular formula C10H17F4O3P and a molecular weight of 292.21 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-(2-fluorocyclohexyl)butan-2-yl]phosphonic acid.
| Compound Name | [4,4,4-trifluoro-2-(2-fluorocyclohexyl)butan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 66796837 |
| Molecular Formula | C10H17F4O3P |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [4,4,4-trifluoro-2-(2-fluorocyclohexyl)butan-2-yl]phosphonic acid |
| SMILES | CC(CC(F)(F)F)(C1CCCCC1F)P(=O)(O)O |
| InChI | InChI=1S/C10H17F4O3P/c1-9(18(15,16)17,6-10(12,13)14)7-4-2-3-5-8(7)11/h7-8H,2-6H2,1H3,(H2,15,16,17) |
| InChIKey | JVWUMHCVUYVWJG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|