C12H21F4O3P — CID 66796861
[1,1,1-trifluoro-3-(2-fluorocyclohexyl)hexan-3-yl]phosphonic acid (PubChem CID 66796861) has the molecular formula C12H21F4O3P and a molecular weight of 320.26 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(2-fluorocyclohexyl)hexan-3-yl]phosphonic acid.
| Compound Name | [1,1,1-trifluoro-3-(2-fluorocyclohexyl)hexan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 66796861 |
| Molecular Formula | C12H21F4O3P |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [1,1,1-trifluoro-3-(2-fluorocyclohexyl)hexan-3-yl]phosphonic acid |
| SMILES | CCCC(CC(F)(F)F)(C1CCCCC1F)P(=O)(O)O |
| InChI | InChI=1S/C12H21F4O3P/c1-2-7-11(20(17,18)19,8-12(14,15)16)9-5-3-4-6-10(9)13/h9-10H,2-8H2,1H3,(H2,17,18,19) |
| InChIKey | SKTRVBSMGYTILX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|