About [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid
[2,3-bis(2-fluorophenyl)phenyl]phosphonic acid (PubChem CID 66796961) has the molecular formula C18H13F2O3P
and a molecular weight of 346.27 g/mol. Its IUPAC name is [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid.
Molecular Properties
| Compound Name | [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid |
| PubChem CID | 66796961 |
| Molecular Formula | C18H13F2O3P |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1cccc(-c2ccccc2F)c1-c1ccccc1F |
| InChI | InChI=1S/C18H13F2O3P/c19-15-9-3-1-6-12(15)13-8-5-11-17(24(21,22)23)18(13)14-7-2-4-10-16(14)20/h1-11H,(H2,21,22,23) |
| InChIKey | LOMPZYNLZSIWPB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid?
The IUPAC name of [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid (CID 66796961) is [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid.
What is the SMILES notation for [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid?
The canonical SMILES for [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid is O=P(O)(O)c1cccc(-c2ccccc2F)c1-c1ccccc1F.
What is the InChIKey of [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid?
The InChIKey is LOMPZYNLZSIWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2O3P/c19-15-9-3-1-6-12(15)13-8-5-11-17(24(21,22)23)18(13)14-7-2-4-10-16(14)20/h1-11H,(H2,21,22,23).
What are the key properties of [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid?
[2,3-bis(2-fluorophenyl)phenyl]phosphonic acid has a molecular weight of 346.27 g/mol, XLogP of 4.10, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(2-fluorophenyl)phenyl]phosphonic acid is sourced from PubChem (CID 66796961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).