C18H23Cl3N4O — CID 66797152
N-(4-chlorophenyl)-2-(2-pyridin-3-ylethyl)piperazine-1-carboxamide;dihydrochloride (PubChem CID 66797152) has the molecular formula C18H23Cl3N4O and a molecular weight of 417.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2-pyridin-3-ylethyl)piperazine-1-carboxamide;dihydrochloride.
| Compound Name | N-(4-chlorophenyl)-2-(2-pyridin-3-ylethyl)piperazine-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 66797152 |
| Molecular Formula | C18H23Cl3N4O |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2-pyridin-3-ylethyl)piperazine-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(Cl)cc1)N1CCNCC1CCc1cccnc1 |
| InChI | InChI=1S/C18H21ClN4O.2ClH/c19-15-4-6-16(7-5-15)22-18(24)23-11-10-21-13-17(23)8-3-14-2-1-9-20-12-14;;/h1-2,4-7,9,12,17,21H,3,8,10-11,13H2,(H,22,24);2*1H |
| InChIKey | KLBPEMPPYQRGKW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |