About ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate
ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate (PubChem CID 66797600) has the molecular formula C21H31NO5
and a molecular weight of 377.48 g/mol. Its IUPAC name is ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate |
| PubChem CID | 66797600 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(OC(=O)Cc2c(C)cc(C)cc2C)CCN(OCC)CC1 |
| InChI | InChI=1S/C21H31NO5/c1-6-25-20(24)21(8-10-22(11-9-21)26-7-2)27-19(23)14-18-16(4)12-15(3)13-17(18)5/h12-13H,6-11,14H2,1-5H3 |
| InChIKey | JZMMRUSAIMZGIZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
The IUPAC name of ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate (CID 66797600) is ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
The canonical SMILES for ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate is CCOC(=O)C1(OC(=O)Cc2c(C)cc(C)cc2C)CCN(OCC)CC1.
What is the InChIKey of ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
The InChIKey is JZMMRUSAIMZGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31NO5/c1-6-25-20(24)21(8-10-22(11-9-21)26-7-2)27-19(23)14-18-16(4)12-15(3)13-17(18)5/h12-13H,6-11,14H2,1-5H3.
What are the key properties of ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate has a molecular weight of 377.48 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate is sourced from PubChem (CID 66797600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).