About [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate
[3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (PubChem CID 66797633) has the molecular formula C21H25F2NO6
and a molecular weight of 425.43 g/mol. Its IUPAC name is [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| PubChem CID | 66797633 |
| Molecular Formula | C21H25F2NO6 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2c(C)cc(C(F)F)cc2C)C(=O)OC12CCN(OC)CC2 |
| InChI | InChI=1S/C21H25F2NO6/c1-5-28-20(26)29-17-16(15-12(2)10-14(18(22)23)11-13(15)3)19(25)30-21(17)6-8-24(27-4)9-7-21/h10-11,18H,5-9H2,1-4H3 |
| InChIKey | YENGTDMVCRBIAM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The IUPAC name of [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (CID 66797633) is [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
What is the SMILES notation for [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The canonical SMILES for [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate is CCOC(=O)OC1=C(c2c(C)cc(C(F)F)cc2C)C(=O)OC12CCN(OC)CC2.
What is the InChIKey of [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The InChIKey is YENGTDMVCRBIAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2NO6/c1-5-28-20(26)29-17-16(15-12(2)10-14(18(22)23)11-13(15)3)19(25)30-21(17)6-8-24(27-4)9-7-21/h10-11,18H,5-9H2,1-4H3.
What are the key properties of [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
[3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate has a molecular weight of 425.43 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(difluoromethyl)-2,6-dimethylphenyl]-8-methoxy-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate is sourced from PubChem (CID 66797633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).