About 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one
3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one (PubChem CID 66797651) has the molecular formula C17H20BrNO4
and a molecular weight of 382.25 g/mol. Its IUPAC name is 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 66797651 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one |
| SMILES | CON1CCC2(CC1)OC(=O)C(c1c(C)ccc(Br)c1C)=C2O |
| InChI | InChI=1S/C17H20BrNO4/c1-10-4-5-12(18)11(2)13(10)14-15(20)17(23-16(14)21)6-8-19(22-3)9-7-17/h4-5,20H,6-9H2,1-3H3 |
| InChIKey | JFPAKAGEMGRYHL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one (CID 66797651) is 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one is CON1CCC2(CC1)OC(=O)C(c1c(C)ccc(Br)c1C)=C2O.
What is the InChIKey of 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one?
The InChIKey is JFPAKAGEMGRYHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20BrNO4/c1-10-4-5-12(18)11(2)13(10)14-15(20)17(23-16(14)21)6-8-19(22-3)9-7-17/h4-5,20H,6-9H2,1-3H3.
What are the key properties of 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one?
3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one has a molecular weight of 382.25 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-2,6-dimethylphenyl)-4-hydroxy-8-methoxy-1-oxa-8-azaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 66797651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).