About methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate
methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate (PubChem CID 66797658) has the molecular formula C20H29NO5
and a molecular weight of 363.45 g/mol. Its IUPAC name is methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate |
| PubChem CID | 66797658 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate |
| SMILES | CCON1CCC(OC(=O)Cc2c(C)cc(C)cc2C)(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H29NO5/c1-6-25-21-9-7-20(8-10-21,19(23)24-5)26-18(22)13-17-15(3)11-14(2)12-16(17)4/h11-12H,6-10,13H2,1-5H3 |
| InChIKey | JNYLRQZSQUIWES-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
The IUPAC name of methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate (CID 66797658) is methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate.
What is the SMILES notation for methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
The canonical SMILES for methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate is CCON1CCC(OC(=O)Cc2c(C)cc(C)cc2C)(C(=O)OC)CC1.
What is the InChIKey of methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
The InChIKey is JNYLRQZSQUIWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO5/c1-6-25-21-9-7-20(8-10-21,19(23)24-5)26-18(22)13-17-15(3)11-14(2)12-16(17)4/h11-12H,6-10,13H2,1-5H3.
What are the key properties of methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate?
methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate has a molecular weight of 363.45 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-ethoxy-4-[2-(2,4,6-trimethylphenyl)acetyl]oxypiperidine-4-carboxylate is sourced from PubChem (CID 66797658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).