C65H46N4O — CID 66797698
bis[3-[3-(14,14-dimethyl-6,10-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-10-yl)phenyl]phenyl]methanone (PubChem CID 66797698) has the molecular formula C65H46N4O and a molecular weight of 899.11 g/mol. Its IUPAC name is bis[3-[3-(14,14-dimethyl-6,10-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-10-yl)phenyl]phenyl]methanone.
| Compound Name | bis[3-[3-(14,14-dimethyl-6,10-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-10-yl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 66797698 |
| Molecular Formula | C65H46N4O |
| Molecular Weight | 899.11 g/mol |
| Exact Mass | 898.37 |
| IUPAC Name | bis[3-[3-(14,14-dimethyl-6,10-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-10-yl)phenyl]phenyl]methanone |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cnccc4n(-c4cccc(-c5cccc(C(=O)c6cccc(-c7cccc(-n8c9ccncc9c9cc%10c(cc98)C(C)(C)c8ccccc8-%10)c7)c6)c5)c4)c3cc21 |
| InChI | InChI=1S/C65H46N4O/c1-64(2)55-23-7-5-21-47(55)49-33-51-53-37-66-27-25-59(53)68(61(51)35-57(49)64)45-19-11-15-41(31-45)39-13-9-17-43(29-39)63(70)44-18-10-14-40(30-44)42-16-12-20-46(32-42)69-60-26-28-67-38-54(60)52-34-50-48-22-6-8-24-56(48)65(3,4)58(50)36-62(52)69/h5-38H,1-4H3 |
| InChIKey | ILAQUBHJQKEFCW-UHFFFAOYSA-N |
| XLogP | 15.85 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.11 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |